Information card for entry 2005152
| Chemical name |
4,5,6,7,8,9-Hexahydro-10-hydroxy-5,9-methano-4H-thieno[3,2-c]azonine, C~11~H~15~NOS |
| Formula |
C11 H15 N O S |
| Calculated formula |
C11 H15 N O S |
| SMILES |
s1ccc2CN3CCC[C@H]([C@@H](c12)O)C3.s1ccc2CN3CCC[C@@H]([C@H](c12)O)C3 |
| Title of publication |
5,6,7,8,9,10-Hexahydro-10-hydroxy-5,9-methano-4<i>H</i>-thieno[3,2-<i>c</i>]azonine |
| Authors of publication |
Kozísek, J.; Berkes, D.; Svoboda, I.; Decroix, B. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
7 |
| Pages of publication |
1825 - 1826 |
| a |
14.15 ± 0.003 Å |
| b |
6.257 ± 0.002 Å |
| c |
12.433 ± 0.002 Å |
| α |
90° |
| β |
109.4 ± 0.01° |
| γ |
90° |
| Cell volume |
1038.3 ± 0.4 Å3 |
| Cell temperature |
299 ± 2 K |
| Ambient diffraction temperature |
299 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0329 |
| Residual factor for significantly intense reflections |
0.0305 |
| Weighted residual factors for all reflections |
0.0831 |
| Weighted residual factors for significantly intense reflections |
0.0812 |
| Goodness-of-fit parameter for all reflections |
1.082 |
| Goodness-of-fit parameter for significantly intense reflections |
1.096 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2005152.html