Information card for entry 2012965
| Chemical name |
Bis(2,2'-bipyridine-κ^2^N,N')(dicyanamido-κN')copper(II) perchlorate |
| Formula |
C22 H16 Cl Cu N7 O4 |
| Calculated formula |
C22 H16 Cl Cu N7 O4 |
| SMILES |
Cl(=O)(=O)(=O)[O-].[Cu]12([N]#C[N-]C#N)([n]3c(cccc3)c3[n]1cccc3)[n]1c(cccc1)c1[n]2cccc1 |
| Title of publication |
Low-dimensional compounds containing cyano groups. IV. Bis(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>^1^)(dicyanamido-κ<i>N</i>')copper(II) perchlorate and μ-dicyanamido-κ^2^<i>N</i>^1^:<i>N</i>^5^-bis[bis(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')copper(II)] triperchlorate ethanol hemisolvate, complexes with unusual dicyanamide coordination |
| Authors of publication |
Potočňák, Ivan; Burčák, Milan; Massa, Werner; Jäger, Lothar |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
10 |
| Pages of publication |
m523 - m528 |
| a |
8.7343 ± 0.0004 Å |
| b |
17.945 ± 0.0009 Å |
| c |
28.723 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4502 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.064 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.084 |
| Weighted residual factors for all reflections included in the refinement |
0.091 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.969 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012965.html