Information card for entry 2015103
| Chemical name |
1,2,3-Trimethoxy-5,11-dihydroindolo[1,2-b]isoquinoline-5,11-dione |
| Formula |
C19 H15 N O5 |
| Calculated formula |
C19 H15 N O5 |
| SMILES |
COc1cc2c(c(c1OC)OC)cc1n(c2=O)c2ccccc2C1=O |
| Title of publication |
1,2,3-Trimethoxy-5,11-dihydroindolo[1,2-<i>b</i>]isoquinoline-5,11-dione |
| Authors of publication |
M. Yogavel; D. Velmurugan; W. G. Rajeswaran; P. C. Srinivasan; H.-K. Fun |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
o715 - o717 |
| a |
20.8934 ± 0.0004 Å |
| b |
14.24 ± 0.0003 Å |
| c |
22.8886 ± 0.0004 Å |
| α |
90° |
| β |
110.014 ± 0.001° |
| γ |
90° |
| Cell volume |
6398.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1423 |
| Residual factor for significantly intense reflections |
0.0677 |
| Weighted residual factors for significantly intense reflections |
0.1674 |
| Weighted residual factors for all reflections included in the refinement |
0.2099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015103.html