Information card for entry 2015104
| Common name |
mercury(II) (-)-sparteine dichloride |
| Chemical name |
Dichloro[(6R,7S,8S,14S)-(-)-sparteine-κ^2^N,N']mercury(II) |
| Formula |
C15 H26 Cl2 Hg N2 |
| Calculated formula |
C15 H26 Cl2 Hg N2 |
| SMILES |
[Hg]1(Cl)(Cl)[N]23CCCC[C@@H]2[C@@H]2C[N]41CCCC[C@H]4[C@H](C3)C2 |
| Title of publication |
Dichloro[(6<i>R</i>,7<i>S</i>,8<i>S</i>,14<i>S</i>)-(‒)-sparteine-κ^2^<i>N</i>,<i>N</i>']mercury(II) |
| Authors of publication |
Choi, Sung-Nak; Kim, Sang-Yub; Ryu, Hae-Wook; Lee, Yong-Min |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
m504 - m506 |
| a |
11.191 ± 0.003 Å |
| b |
12.1156 ± 0.0011 Å |
| c |
12.6742 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1718.4 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0768 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.0739 |
| Weighted residual factors for all reflections included in the refinement |
0.0821 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015104.html