Information card for entry 2108599
| Formula |
C24 H22 F4 Si2 |
| Calculated formula |
C24 H22 F4 Si2 |
| SMILES |
[Si](C#Cc1c2cc3c(F)c(F)c(F)c(F)c3cc2c(cc1)C#C[Si](C)(C)C)(C)(C)C |
| Title of publication |
Synthesis, crystal structure, polymorphism and microscopic luminescence properties of anthracene derivative compounds |
| Authors of publication |
Moliterni, Anna; Altamura, Davide; Lassandro, Rocco; Olieric, Vincent; Ferri, Gianmarco; Cardarelli, Francesco; Camposeo, Andrea; Pisignano, Dario; Anthony, John E.; Giannini, Cinzia |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
3 |
| a |
6.7352 ± 0.0004 Å |
| b |
14.8514 ± 0.0008 Å |
| c |
23.3648 ± 0.0013 Å |
| α |
90° |
| β |
94.735 ± 0.004° |
| γ |
90° |
| Cell volume |
2329.1 ± 0.2 Å3 |
| Cell temperature |
90 ± 0.2 K |
| Ambient diffraction temperature |
90 ± 0.2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0641 |
| Residual factor for significantly intense reflections |
0.0623 |
| Weighted residual factors for significantly intense reflections |
0.1733 |
| Weighted residual factors for all reflections included in the refinement |
0.1745 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2108599.html