Information card for entry 2202016
| Chemical name |
N,N'-Di-4-methylphenylpyridine-2,6-dicarboxamide |
| Formula |
C21 H19 N3 O2 |
| Calculated formula |
C21 H19 N3 O2 |
| SMILES |
O=C(c1cccc(n1)C(=O)Nc1ccc(cc1)C)Nc1ccc(cc1)C |
| Title of publication |
<i>N,N</i>'-Bis(4-methylphenyl)pyridine-2,6-dicarboxamide |
| Authors of publication |
Qi, Jian Ying; Yang, Qi Yun; Lam, Kim Hung; Zhou, Zhong Yuan; Chan, Albert S. C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
4 |
| Pages of publication |
o415 - o416 |
| a |
25.14 ± 0.005 Å |
| b |
8.5779 ± 0.0017 Å |
| c |
8.5295 ± 0.0017 Å |
| α |
90° |
| β |
94.46 ± 0.03° |
| γ |
90° |
| Cell volume |
1833.8 ± 0.6 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1989 |
| Residual factor for significantly intense reflections |
0.0893 |
| Weighted residual factors for significantly intense reflections |
0.1593 |
| Weighted residual factors for all reflections included in the refinement |
0.1806 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202016.html