Information card for entry 2202017
| Chemical name |
2,3-Dimethyl 5-isopropyl 1-ethoxymethyl-6-methyl-4-(3-nitrophenyl)-1,4- dihydropyridine-2,3,5-tricarboxylate |
| Formula |
C23 H28 N2 O9 |
| Calculated formula |
C23 H28 N2 O9 |
| SMILES |
O(CN1C(=C(C(C(=C1C)C(=O)OC(C)C)c1cc(N(=O)=O)ccc1)C(=O)OC)C(=O)OC)CC |
| Title of publication |
2,3-Dimethyl 5-isopropyl 1-ethoxymethyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-2,3,5-tricarboxylate |
| Authors of publication |
Vrabel, Victor; Oktavec, Drahomír; Marchalín, Štefan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
3 |
| Pages of publication |
o306 - o307 |
| a |
9.291 ± 0.004 Å |
| b |
9.589 ± 0.003 Å |
| c |
27.175 ± 0.013 Å |
| α |
90° |
| β |
99.53 ± 0.03° |
| γ |
90° |
| Cell volume |
2387.6 ± 1.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.2424 |
| Residual factor for significantly intense reflections |
0.0588 |
| Weighted residual factors for significantly intense reflections |
0.0736 |
| Weighted residual factors for all reflections included in the refinement |
0.0834 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.928 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202017.html