Information card for entry 2202280
| Common name |
2,4,6-Trimethyl-1,3,5-tris(phenoxymethyl)benzene |
| Chemical name |
2,4,6-Trimethyl-1,3,5-tris(phenoxymethyl)benzene |
| Formula |
C30 H30 O3 |
| Calculated formula |
C30 H30 O3 |
| SMILES |
c1(c(c(c(c(c1C)COc1ccccc1)C)COc1ccccc1)C)COc1ccccc1 |
| Title of publication |
2,4,6-Trimethyl-1,3,5-tris(phenoxymethyl)benzene |
| Authors of publication |
David J. Bray; Leonard F. Lindoy; John C. McMurtrie |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
10 |
| Pages of publication |
o1544 - o1545 |
| a |
16.103 ± 0.003 Å |
| b |
10.8827 ± 0.0019 Å |
| c |
27.396 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4801 ± 1.5 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0398 |
| Residual factor for significantly intense reflections |
0.0345 |
| Weighted residual factors for significantly intense reflections |
0.0899 |
| Weighted residual factors for all reflections included in the refinement |
0.0935 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202280.html