Information card for entry 2218273
| Chemical name |
17α-Ethynyl-3-methoxyestra-1,3,5(10),9(11)-tetraen-17-ol |
| Formula |
C21 H24 O2 |
| Calculated formula |
C21 H24 O2 |
| SMILES |
O(c1ccc2c(c1)CC[C@@H]1C2=CC[C@]2([C@H]1CC[C@@]2(O)C#C)C)C |
| Title of publication |
17α-Ethynyl-3-methoxyestra-1,3,5(10),9(11)-tetraen-17-ol |
| Authors of publication |
Li, Hongqi; Song, Yanxi; Ge, Fengyan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o783 |
| a |
7.3773 ± 0.0006 Å |
| b |
10.743 ± 0.0009 Å |
| c |
21.2555 ± 0.0018 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1684.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.1105 |
| Weighted residual factors for all reflections included in the refinement |
0.1141 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218273.html