Information card for entry 2218274
| Chemical name |
(<i>Z</i>)-1,3,4a-Trimethyl-5,5-diphenyl-6-oxa-1,3-diazabicyclo[4.2.0]octane- 2,4-dione |
| Formula |
C20 H20 N2 O3 |
| Calculated formula |
C20 H20 N2 O3 |
| SMILES |
N1([C@H]2OC([C@]2(C(=O)N(C1=O)C)C)(c1ccccc1)c1ccccc1)C.N1([C@@H]2OC([C@@]2(C(=O)N(C1=O)C)C)(c1ccccc1)c1ccccc1)C |
| Title of publication |
(<i>Z</i>)-1,3,4a-Trimethyl-5,5-diphenyl-6-oxa-1,3-diazabicyclo[4.2.0]octane-2,4-dione |
| Authors of publication |
Lin, Zhi-Cai; Shi, Jing-Bo; Tang, Wen-Jian; Li, Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
5 |
| Pages of publication |
o796 |
| a |
8.1341 ± 0.0007 Å |
| b |
9.1004 ± 0.0013 Å |
| c |
23.485 ± 0.002 Å |
| α |
90° |
| β |
97.334 ± 0.002° |
| γ |
90° |
| Cell volume |
1724.2 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0887 |
| Residual factor for significantly intense reflections |
0.0437 |
| Weighted residual factors for significantly intense reflections |
0.0917 |
| Weighted residual factors for all reflections included in the refinement |
0.1166 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218274.html