Information card for entry 2220007
| Chemical name |
13c-(2-Chloroethoxy)-1,13c-dihydro-2,3-epoxydibenzo[a,kl]xanthan-1-one |
| Formula |
C22 H15 Cl O4 |
| Calculated formula |
C22 H15 Cl O4 |
| SMILES |
ClCCO[C@]12C(=O)[C@@H]3O[C@@H]3c3cccc(Oc4c2c2c(cc4)cccc2)c13 |
| Title of publication |
13c-(2-Chloroethoxy)-1,13c-dihydro-2,3-epoxydibenzo[<i>a</i>,<i>kl</i>]xanthan-1-one |
| Authors of publication |
Chen, Jin-Xiang; Wang, Yu-Qin; Wu, Shu-Guang; Jiang, Zhi-Hong; Chen, Zhi-Peng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
11 |
| Pages of publication |
o2069 |
| a |
7.7966 ± 0.0013 Å |
| b |
10.4468 ± 0.0018 Å |
| c |
21.349 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1738.9 ± 0.5 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.06 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.124 |
| Weighted residual factors for all reflections included in the refinement |
0.136 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220007.html