Information card for entry 2226291
| Chemical name |
3,3'-Dimethyl-1,1'-(butane-1,4-diyl)diimidazolium bis(tetrafluoroborate) |
| Formula |
C12 H20 B2 F8 N4 |
| Calculated formula |
C12 H20 B2 F8 N4 |
| SMILES |
[B](F)(F)(F)[F-].Cn1cc[n+](c1)CCCC[n+]1ccn(C)c1.[B](F)(F)(F)[F-] |
| Title of publication |
3,3'-Dimethyl-1,1'-(butane-1,4-diyl)diimidazolium bis(tetrafluoroborate) |
| Authors of publication |
Geng, Hao; Zhuang, Ling-hua; Zhang, Jian; Wang, Guo-wei; Yuan, Ai-lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1267 |
| a |
5.195 ± 0.001 Å |
| b |
14.836 ± 0.003 Å |
| c |
11.79 ± 0.002 Å |
| α |
90° |
| β |
99.53 ± 0.03° |
| γ |
90° |
| Cell volume |
896.2 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0832 |
| Residual factor for significantly intense reflections |
0.0464 |
| Weighted residual factors for significantly intense reflections |
0.1299 |
| Weighted residual factors for all reflections included in the refinement |
0.1546 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.005 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226291.html