Information card for entry 2226840
| Chemical name |
Amino(5-{2-[amino(iminio)methyl]hydrazin-1-yl}-3,5-dimethyl-4,5-dihydro- 1<i>H</i>-pyrazol-1-yl)methaniminium dinitrate |
| Formula |
C7 H18 N10 O6 |
| Calculated formula |
C7 H18 N10 O6 |
| SMILES |
N1(N=C(C[C@]1(NNC(=[NH2+])N)C)C)C(=[NH2+])N.N(=O)(=O)[O-].N(=O)(=O)[O-] |
| Title of publication |
Amino(5-{2-[amino(iminio)methyl]hydrazin-1-yl}-3,5-dimethyl-4,5-dihydro-1<i>H</i>-pyrazol-1-yl)methaniminium dinitrate |
| Authors of publication |
Novaković, Sladjana B.; Lalović, Mirjana; Divjaković, Vladimir; Vojinović-Ješić, Ljiljana S.; Češljević, Valerija I. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o1916 - o1917 |
| a |
7.5025 ± 0.0002 Å |
| b |
13.8946 ± 0.0004 Å |
| c |
14.2477 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1485.24 ± 0.07 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0564 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.1088 |
| Weighted residual factors for all reflections included in the refinement |
0.1137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226840.html