Information card for entry 2226841
| Chemical name |
(<i>E</i>)-3-[1-(2,4-Difluorophenyl)ethyl]-5-methyl-<i>N</i>-nitro-1,3,5- oxadiazinan-4-imine |
| Formula |
C12 H14 F2 N4 O3 |
| Calculated formula |
C12 H14 F2 N4 O3 |
| SMILES |
Fc1c(C(N2/C(N(COC2)C)=N\N(=O)=O)C)ccc(F)c1 |
| Title of publication |
(<i>E</i>)-3-[1-(2,4-Difluorophenyl)ethyl]-5-methyl-<i>N</i>-nitro-1,3,5-oxadiazinan-4-imine |
| Authors of publication |
Zhong, Yuan-yuan; Li, Cong-cong; Xu, Liang-zhong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o1981 |
| a |
13.385 ± 0.003 Å |
| b |
6.747 ± 0.0013 Å |
| c |
15.073 ± 0.003 Å |
| α |
90° |
| β |
101.25 ± 0.03° |
| γ |
90° |
| Cell volume |
1335.1 ± 0.5 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0444 |
| Residual factor for significantly intense reflections |
0.0398 |
| Weighted residual factors for significantly intense reflections |
0.102 |
| Weighted residual factors for all reflections included in the refinement |
0.1062 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226841.html