Information card for entry 2228709
| Chemical name |
Bis[1,3-bis(2,4,6-trimethylphenyl)-2,3-dihydro-1<i>H</i>-imidazol-2- ylidene]dinitrosyl(tetrahydroborato-κ^2^<i>H</i>,<i>H</i>')tungsten(0) |
| Formula |
C42 H52 B N6 O2 W |
| Calculated formula |
C42 H52 B N6 O2 W |
| SMILES |
[W]1([H][BH2][H]1)(N=O)(N=O)(=C1N(C=CN1c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C)=C1N(C=CN1c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C |
| Title of publication |
Bis[1,3-bis(2,4,6-trimethylphenyl)-2,3-dihydro-1<i>H</i>-imidazol-2-ylidene]dinitrosyl(tetrahydroborato-κ^2^<i>H</i>,<i>H</i>')tungsten(0) |
| Authors of publication |
Fraga-Hernández, Javier; Blacque, Olivier; Berke, Heinz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
m94 - m95 |
| a |
24.7322 ± 0.0013 Å |
| b |
11.2183 ± 0.0005 Å |
| c |
15.0522 ± 0.0008 Å |
| α |
90° |
| β |
97.643 ± 0.006° |
| γ |
90° |
| Cell volume |
4139.2 ± 0.4 Å3 |
| Cell temperature |
183 ± 2 K |
| Ambient diffraction temperature |
183 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for all reflections included in the refinement |
0.1132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228709.html