Information card for entry 2228710
| Chemical name |
3-[4-(Dimethylamino)phenyl]-1-(4a,8-dimethyl-1,2,3,4,4a,5,6,8a- octahydronaphthalen-2-yl)prop-2-en-1-one |
| Formula |
C23 H31 N O |
| Calculated formula |
C23 H31 N O |
| SMILES |
c1(ccc(cc1)/C=C/C(=O)[C@H]1CC[C@@]2(CCC=C([C@H]2C1)C)C)N(C)C |
| Title of publication |
3-[4-(Dimethylamino)phenyl]-1-(4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-2-yl)prop-2-en-1-one |
| Authors of publication |
Tebbaa, Mohamed; Akssira, Mohamed; Elhakmaoui, Ahmed; Benharref, Ahmed; Daran, Jean-Claude; Berraho, Moha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o237 |
| a |
6.0593 ± 0.0004 Å |
| b |
7.2095 ± 0.0007 Å |
| c |
21.8937 ± 0.0019 Å |
| α |
90° |
| β |
91.86 ± 0.007° |
| γ |
90° |
| Cell volume |
955.91 ± 0.14 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0377 |
| Residual factor for significantly intense reflections |
0.0327 |
| Weighted residual factors for significantly intense reflections |
0.0864 |
| Weighted residual factors for all reflections included in the refinement |
0.0886 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228710.html