Information card for entry 2229413
| Chemical name |
4-(2,4,6-Trimethylbenzyl)-1,3-thiazol-2-amine |
| Formula |
C13 H16 N2 S |
| Calculated formula |
C13 H16 N2 S |
| SMILES |
s1c(N)nc(c1)Cc1c(cc(cc1C)C)C |
| Title of publication |
4-(2,4,6-Trimethylbenzyl)-1,3-thiazol-2-amine |
| Authors of publication |
Maharramov, Abel M.; Khalilov, Ali N.; Gurbanov, Atash V.; Allahverdiyev, Mirze A.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o721 |
| a |
5.5028 ± 0.0005 Å |
| b |
30.832 ± 0.003 Å |
| c |
7.8355 ± 0.0007 Å |
| α |
90° |
| β |
110.016 ± 0.001° |
| γ |
90° |
| Cell volume |
1249.1 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0495 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for significantly intense reflections |
0.1162 |
| Weighted residual factors for all reflections included in the refinement |
0.1201 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229413.html