Information card for entry 2230379
| Chemical name |
(<i>E</i>,<i>E</i>)-1,2-Bis(2,4,5-trimethoxybenzylidene)hydrazine |
| Formula |
C20 H24 N2 O6 |
| Calculated formula |
C20 H24 N2 O6 |
| SMILES |
COc1cc(OC)c(cc1/C=N/N=C/c1cc(OC)c(cc1OC)OC)OC |
| Title of publication |
(<i>E</i>,<i>E</i>)-1,2-Bis(2,4,5-trimethoxybenzylidene)hydrazine |
| Authors of publication |
Fun, Hoong-Kun; Jansrisewangwong, Patcharaporn; Karalai, Chatchanok; Chantrapromma, Suchada |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1526 - o1527 |
| a |
7.5056 ± 0.0001 Å |
| b |
7.2523 ± 0.0001 Å |
| c |
17.4489 ± 0.0002 Å |
| α |
90° |
| β |
90.6 ± 0.001° |
| γ |
90° |
| Cell volume |
949.74 ± 0.02 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.045 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1066 |
| Weighted residual factors for all reflections included in the refinement |
0.1125 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230379.html