Information card for entry 2230380
| Chemical name |
(1<i>S</i>,3<i>S</i>)-Methyl 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| Formula |
C19 H21 N O4 |
| Calculated formula |
C19 H21 N O4 |
| SMILES |
O(c1cc2[C@@H](N[C@@H](Cc2cc1OC)C(=O)OC)c1ccccc1)C |
| Title of publication |
(1<i>S</i>,3<i>S</i>)-Methyl 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| Authors of publication |
Naicker, Tricia; Govender, Thavendran; Kruger, Hendrik G.; Maguire, Glenn E. M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1501 |
| a |
9.3841 ± 0.0003 Å |
| b |
6.3453 ± 0.0002 Å |
| c |
14.2048 ± 0.0004 Å |
| α |
90° |
| β |
94.475 ± 0.002° |
| γ |
90° |
| Cell volume |
843.25 ± 0.04 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0331 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for significantly intense reflections |
0.0795 |
| Weighted residual factors for all reflections included in the refinement |
0.082 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230380.html