Information card for entry 2230485
| Common name |
Hopeahainol C monohydrate |
| Chemical name |
3,11-bis(4-hydroxyphenyl)-4,12- dioxapentacyclo[8.6.1.1^2,5^.0^13,17^.0^9,18^]octadeca- 1(16),2,5(18),6,8,10,13(17),14-octaene-7,15-diol monohydrate |
| Formula |
C28 H18 O7 |
| Calculated formula |
C28 H18 O7 |
| SMILES |
Oc1cc2oc(c3c2c(c1)c1c(oc2c1c3cc(c2)O)c1ccc(cc1)O)c1ccc(cc1)O.O |
| Title of publication |
Hopeahainol C monohydrate |
| Authors of publication |
Fun, Hoong-Kun; Sudto, Kanokorn; Ge, Hui-Ming; Tan, Ren-Xiang; Hannongbua, Supa; Chantrapromma, Suchada |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1392 - o1393 |
| a |
21.225 ± 0.004 Å |
| b |
3.85 ± 0.0007 Å |
| c |
25.353 ± 0.005 Å |
| α |
90° |
| β |
108.933 ± 0.004° |
| γ |
90° |
| Cell volume |
1959.7 ± 0.6 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.106 |
| Residual factor for significantly intense reflections |
0.0678 |
| Weighted residual factors for significantly intense reflections |
0.1467 |
| Weighted residual factors for all reflections included in the refinement |
0.1609 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230485.html