Information card for entry 2230486
| Chemical name |
2,6-Bis(2-chlorophenyl)-4-oxo-3,5-diphenylheptane-1,1,7,7-tetracarbonitrile |
| Formula |
C35 H24 Cl2 N4 O |
| Calculated formula |
C35 H24 Cl2 N4 O |
| SMILES |
C([C@H]([C@H](C(=O)[C@@H]([C@@H](C(C#N)C#N)c1ccccc1Cl)c1ccccc1)c1ccccc1)c1ccccc1Cl)(C#N)C#N.C([C@@H]([C@@H](C(=O)[C@H]([C@H](C(C#N)C#N)c1ccccc1Cl)c1ccccc1)c1ccccc1)c1ccccc1Cl)(C#N)C#N |
| Title of publication |
2,6-Bis(2-chlorophenyl)-4-oxo-3,5-diphenylheptane-1,1,7,7-tetracarbonitrile |
| Authors of publication |
Ali, A. Jahubar; Athimoolam, S.; Bahadur, S. Asath; Raja, V. P. Alex |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1407 - o1408 |
| a |
17.7226 ± 0.0006 Å |
| b |
10.6169 ± 0.0003 Å |
| c |
20.8491 ± 0.0007 Å |
| α |
90° |
| β |
113.724 ± 0.002° |
| γ |
90° |
| Cell volume |
3591.4 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0964 |
| Residual factor for significantly intense reflections |
0.0607 |
| Weighted residual factors for significantly intense reflections |
0.1923 |
| Weighted residual factors for all reflections included in the refinement |
0.2109 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230486.html