Information card for entry 2232451
| Chemical name |
(3,6-Dimethoxynaphthalen-2-yl)(2,4,6-trimethylphenyl)methanone |
| Formula |
C22 H22 O3 |
| Calculated formula |
C22 H22 O3 |
| SMILES |
O=C(c1c(OC)cc2c(c1)ccc(OC)c2)c1c(cc(cc1C)C)C |
| Title of publication |
(3,6-Dimethoxynaphthalen-2-yl)(2,4,6-trimethylphenyl)methanone |
| Authors of publication |
Muto, Toyokazu; Sasagawa, Kosuke; Okamoto, Akiko; Oike, Hideaki; Yonezawa, Noriyuki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o3062 |
| a |
15.4205 ± 0.0002 Å |
| b |
8.23702 ± 0.0001 Å |
| c |
15.3832 ± 0.0002 Å |
| α |
90° |
| β |
111.3 ± 0.01° |
| γ |
90° |
| Cell volume |
1820.49 ± 0.13 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0454 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1282 |
| Weighted residual factors for all reflections included in the refinement |
0.1303 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232451.html