Information card for entry 2232452
| Chemical name |
Ethyl 6-methyl-3-(2-methylprop-1-enyl)-2-oxo-4-phenyl- 1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C18 H22 N2 O3 |
| Calculated formula |
C18 H22 N2 O3 |
| SMILES |
C1(=C(C)NC(=O)N(C1c1ccccc1)C=C(C)C)C(=O)OCC |
| Title of publication |
Ethyl 6-methyl-3-(2-methylprop-1-enyl)-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Wang, Xi-Cun; Tang, Xue-Hong; Da, Yu-Xia; Zhang, Zhang; Quan, Zheng-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2993 |
| a |
14.114 ± 0.004 Å |
| b |
8.298 ± 0.002 Å |
| c |
14.629 ± 0.004 Å |
| α |
90° |
| β |
93.959 ± 0.002° |
| γ |
90° |
| Cell volume |
1709.2 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.066 |
| Residual factor for significantly intense reflections |
0.0502 |
| Weighted residual factors for significantly intense reflections |
0.1157 |
| Weighted residual factors for all reflections included in the refinement |
0.1292 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.963 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232452.html