Information card for entry 2232552
| Chemical name |
6',7'-Dimethoxy-1',2'-dihydrospiro[cyclohexane-1,2'-quinazoline]-4'(3'<i>H</i>)-one |
| Formula |
C15 H20 N2 O3 |
| Calculated formula |
C15 H20 N2 O3 |
| SMILES |
O(c1cc2NC3(NC(=O)c2cc1OC)CCCCC3)C |
| Title of publication |
6',7'-Dimethoxy-1',2'-dihydrospiro[cyclohexane-1,2'-quinazolin]-4'(3'<i>H</i>)-one |
| Authors of publication |
Zhang, Li-Jun; Song, Yang; Luo, Xiang-Ning; Li, Hui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3389 |
| a |
11.667 ± 0.002 Å |
| b |
9.6376 ± 0.0019 Å |
| c |
12.307 ± 0.003 Å |
| α |
90° |
| β |
101.02 ± 0.03° |
| γ |
90° |
| Cell volume |
1358.3 ± 0.5 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0432 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.0964 |
| Weighted residual factors for all reflections included in the refinement |
0.1 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232552.html