Information card for entry 2233918
| Chemical name |
2-(4-Methoxybenzylidene)-2<i>H</i>-1,3-benzodithiole 1,1,3,3-tetraoxide |
| Formula |
C15 H12 O5 S2 |
| Calculated formula |
C15 H12 O5 S2 |
| SMILES |
S1(=O)(=O)c2c(S(=O)(=O)C1=Cc1ccc(OC)cc1)cccc2 |
| Title of publication |
2-(4-Methoxybenzylidene)-2<i>H</i>-1,3-benzodithiole 1,1,3,3-tetraoxide |
| Authors of publication |
Asahara, Haruyasu; Mayer, Peter; Mayr, Herbert |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o567 |
| a |
7.3649 ± 0.0002 Å |
| b |
11.4723 ± 0.0003 Å |
| c |
17.6114 ± 0.0005 Å |
| α |
84.345 ± 0.002° |
| β |
84.631 ± 0.002° |
| γ |
71.711 ± 0.002° |
| Cell volume |
1402.89 ± 0.07 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0445 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.0893 |
| Weighted residual factors for all reflections included in the refinement |
0.0933 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.096 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233918.html