Information card for entry 2233919
| Common name |
Diethyl 4,4'-(3,6-dioxaoctane-1,8-diyldioxy)dibenzoate |
| Chemical name |
ethyl 4-[2-(2-{2-[4-(ethoxycarbonyl)phenoxy]ethoxy}ethoxy)ethoxy]benzoate |
| Formula |
C24 H30 O8 |
| Calculated formula |
C24 H30 O8 |
| SMILES |
CCOC(=O)c1ccc(cc1)OCCOCCOCCOc1ccc(cc1)C(=O)OCC |
| Title of publication |
Diethyl 4,4'-(3,6-dioxaoctane-1,8-diyldioxy)dibenzoate |
| Authors of publication |
Ma, Zhen; Qin, Haisha; Lai, Gang; Fan, Jingjie |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o714 |
| a |
9.2471 ± 0.0017 Å |
| b |
12.53 ± 0.002 Å |
| c |
13.275 ± 0.002 Å |
| α |
90° |
| β |
131.528 ± 0.01° |
| γ |
90° |
| Cell volume |
1151.5 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1016 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1318 |
| Weighted residual factors for all reflections included in the refinement |
0.1638 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233919.html