Information card for entry 2234225
| Chemical name |
3-Amino-1-(thiophen-2-yl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
| Formula |
C20 H13 N3 S |
| Calculated formula |
C19.996 H13 N3 S |
| SMILES |
N#Cc1c2c(CCc3c2cccc3)c(c(c1N)C#N)c1cccs1 |
| Title of publication |
3-Amino-1-(thiophen-2-yl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
| Authors of publication |
Al-Youbi, Abdulrahman O.; Asiri, Abdullah M.; Faidallah, Hassan M.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1027 - o1028 |
| a |
9.7882 ± 0.001 Å |
| b |
7.1199 ± 0.0007 Å |
| c |
22.746 ± 0.003 Å |
| α |
90° |
| β |
93.171 ± 0.011° |
| γ |
90° |
| Cell volume |
1582.8 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1148 |
| Residual factor for significantly intense reflections |
0.0664 |
| Weighted residual factors for significantly intense reflections |
0.1341 |
| Weighted residual factors for all reflections included in the refinement |
0.1639 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234225.html