Information card for entry 2237911
| Chemical name |
6-(4-Methylphenyl)-1,3,5-triazine-2,4-diamine–benzoic acid (1/1) |
| Formula |
C17 H17 N5 O2 |
| Calculated formula |
C17 H17 N5 O2 |
| SMILES |
OC(=O)c1ccccc1.Cc1ccc(cc1)c1nc(N)nc(n1)N |
| Title of publication |
6-(4-Methylphenyl)-1,3,5-triazine-2,4-diamine–benzoic acid (1/1) |
| Authors of publication |
Thanigaimani, Kaliyaperumal; Khalib, Nuridayanti Che; Razak, Ibrahim Abdul; Lavanya, Palanisamy; Balasubramani, Kasthuri |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
6 |
| Pages of publication |
o968 - o969 |
| a |
7.4324 ± 0.0005 Å |
| b |
10.9717 ± 0.0003 Å |
| c |
11.2267 ± 0.0003 Å |
| α |
117.202 ± 0.001° |
| β |
101.645 ± 0.002° |
| γ |
94.032 ± 0.002° |
| Cell volume |
783.47 ± 0.06 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.076 |
| Residual factor for significantly intense reflections |
0.0615 |
| Weighted residual factors for significantly intense reflections |
0.1502 |
| Weighted residual factors for all reflections included in the refinement |
0.1567 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.109 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237911.html