Information card for entry 2237912
| Chemical name |
6-(4-Methylphenyl)-1,3,5-triazine-2,4-diamine–4-methylbenzoic acid (1/1) |
| Formula |
C18 H19 N5 O2 |
| Calculated formula |
C18 H19 N5 O2 |
| SMILES |
Cc1ccc(cc1)C(=O)O.Cc1ccc(cc1)c1nc(N)nc(n1)N |
| Title of publication |
6-(4-Methylphenyl)-1,3,5-triazine-2,4-diamine–4-methylbenzoic acid (1/1) |
| Authors of publication |
Thanigaimani, Kaliyaperumal; Arshad, Suhana; Razak, Ibrahim Abdul; Makeshvaran, Duraisamy; Balasubramani, Kasthuri |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
6 |
| Pages of publication |
o970 |
| a |
11.1271 ± 0.0003 Å |
| b |
20.9492 ± 0.0006 Å |
| c |
7.4189 ± 0.0002 Å |
| α |
90° |
| β |
101.321 ± 0.002° |
| γ |
90° |
| Cell volume |
1695.73 ± 0.08 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0584 |
| Residual factor for significantly intense reflections |
0.0553 |
| Weighted residual factors for significantly intense reflections |
0.1332 |
| Weighted residual factors for all reflections included in the refinement |
0.1345 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.187 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237912.html