Information card for entry 4034359
| Formula |
C6 H7 F3 O2 |
| Calculated formula |
C6 H7 F3 O2 |
| SMILES |
F[C@H]1[C@H]2O[C@@H]([C@@H](F)[C@@H]1F)CO2 |
| Title of publication |
Synthesis of 2,3,4-Trideoxy-2,3,4-trifluoroglucose. |
| Authors of publication |
Quiquempoix, Lucas; Wang, Zhong; Graton, Jérôme; Latchem, Peter G.; Light, Mark; Le Questel, Jean-Yves; Linclau, Bruno |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2019 |
| Journal volume |
84 |
| Journal issue |
9 |
| Pages of publication |
5899 - 5906 |
| a |
10.5465 ± 0.0003 Å |
| b |
10.7385 ± 0.0003 Å |
| c |
11.308 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1280.67 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0323 |
| Residual factor for significantly intense reflections |
0.0288 |
| Weighted residual factors for significantly intense reflections |
0.0717 |
| Weighted residual factors for all reflections included in the refinement |
0.0731 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4034359.html