Information card for entry 4071058
| Formula |
C50.5 H34 Cl2 O Ti |
| Calculated formula |
C50.5 H34 Cl2 O Ti |
| SMILES |
[Ti]1234(Cl)(Cl)(Oc5c(cccc5c5ccccc5)c5ccccc5)[cH]5[c]61[c]2([c]13[c]45c2c(c3c1cccc3)cccc2)c1c(c2c6cccc2)cccc1.c1(ccccc1)C |
| Title of publication |
Tetrabenzo[a,c,g,i]fluorenyltitanium(III) and -(IV) Complexes: Syntheses, Reactions, and Catalytic Application |
| Authors of publication |
Schröder, Kai; Haase, Detlev; Saak, Wolfgang; Beckhaus, Ruediger; Kretschmer, Winfried P.; Lützen, Arne |
| Journal of publication |
Organometallics |
| Year of publication |
2008 |
| Journal volume |
27 |
| Journal issue |
8 |
| Pages of publication |
1859 |
| a |
9.5715 ± 0.0008 Å |
| b |
12.8182 ± 0.001 Å |
| c |
16.3538 ± 0.0014 Å |
| α |
92.982 ± 0.01° |
| β |
95.251 ± 0.01° |
| γ |
109.988 ± 0.01° |
| Cell volume |
1870.2 ± 0.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0534 |
| Residual factor for significantly intense reflections |
0.0401 |
| Weighted residual factors for significantly intense reflections |
0.1083 |
| Weighted residual factors for all reflections included in the refinement |
0.1141 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4071058.html