Information card for entry 4071059
| Formula |
C41.5 H39 Cl2 N O Ti |
| Calculated formula |
C41.5 H39 Cl2 N O Ti |
| SMILES |
[Ti]1234(Cl)(Cl)(ON5C(CCCC5(C)C)(C)C)[cH]5[c]61c1ccccc1c1ccccc1[c]26[c]13[c]45c2c(c3c1cccc3)cccc2.c1(ccccc1)C |
| Title of publication |
Tetrabenzo[a,c,g,i]fluorenyltitanium(III) and -(IV) Complexes: Syntheses, Reactions, and Catalytic Application |
| Authors of publication |
Schröder, Kai; Haase, Detlev; Saak, Wolfgang; Beckhaus, Ruediger; Kretschmer, Winfried P.; Lützen, Arne |
| Journal of publication |
Organometallics |
| Year of publication |
2008 |
| Journal volume |
27 |
| Journal issue |
8 |
| Pages of publication |
1859 |
| a |
10.2441 ± 0.0005 Å |
| b |
14.2527 ± 0.0007 Å |
| c |
14.5183 ± 0.0007 Å |
| α |
62.46 ± 0.005° |
| β |
75.719 ± 0.006° |
| γ |
70.775 ± 0.006° |
| Cell volume |
1763.42 ± 0.18 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0492 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.1075 |
| Weighted residual factors for all reflections included in the refinement |
0.1119 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4071059.html