Information card for entry 7012325
| Formula |
C10 H14 Cl2 O2 Te |
| Calculated formula |
C10 H14 Cl2 O2 Te |
| SMILES |
[Te](Cl)(Cl)(c1c(OC)cccc1OC)CC |
| Title of publication |
Dependence of the rotational barrier of the Ar-group in RArTeX2 on the R-group [Ar = 2,6-(MeO)2C6H3; R = Me, Et, i-Pr; X = Cl, Br, I] |
| Authors of publication |
Asahara, Masahiro; Taomoto, Shoichiro; Tanaka, Masahito; Erabi, Tatsuo; Wada, Masanori |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2003 |
| Journal issue |
5 |
| Pages of publication |
973 |
| a |
6.7317 ± 0.0002 Å |
| b |
15.2528 ± 0.0003 Å |
| c |
25.9327 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2662.7 ± 0.11 Å3 |
| Cell temperature |
173.1 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.02 |
| Weighted residual factors for all reflections included in the refinement |
0.071 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7012325.html