Information card for entry 7034150
| Formula |
C40 H30 Mn2 N8 O6 |
| Calculated formula |
C40 H30 Mn2 N8 O6 |
| SMILES |
C1(=O)c2cc3c4c(cccc4)O[Mn]45([n]3n2[Mn]2([n]3ccccc3)(O1)([n]1c(cc(C(=O)O5)n41)c1c(cccc1)O2)[n]1ccccc1)([n]1ccccc1)[n]1ccccc1 |
| Title of publication |
Solvent dependent reactivities of di-, tetra- and hexanuclear manganese complexes: syntheses, structures and magnetic properties. |
| Authors of publication |
Yang, Hua; Cao, Fan; Li, Dacheng; Zeng, Suyuan; Song, You; Dou, Jianmin |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2015 |
| Journal volume |
44 |
| Journal issue |
14 |
| Pages of publication |
6620 - 6629 |
| a |
9.4334 ± 0.0007 Å |
| b |
10.5064 ± 0.001 Å |
| c |
11.3707 ± 0.0012 Å |
| α |
64.163 ± 0.001° |
| β |
68.397 ± 0.001° |
| γ |
70.361 ± 0.002° |
| Cell volume |
922.05 ± 0.15 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0422 |
| Residual factor for significantly intense reflections |
0.0326 |
| Weighted residual factors for significantly intense reflections |
0.0818 |
| Weighted residual factors for all reflections included in the refinement |
0.09 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7034150.html
