Information card for entry 7120496
| Formula |
C29 H20 Cl2 N2 Pt S2 |
| Calculated formula |
C29 H20 Cl2 N2 Pt S2 |
| SMILES |
[Pt]12(Sc3c(S1)cc1c4c5ccccc5ccc4ccc1c3)[n]1ccccc1c1[n]2cccc1.ClCCl |
| Title of publication |
Triplet state CPL active helicene-dithiolene platinum bipyridine complexes |
| Authors of publication |
Biet, Thomas; Cauchy, Thomas; Sun, Qinchao; Ding, Jie; Hauser, Andreas; Oulevey, Patric; Bürgi, Thomas; Jacquemin, Denis; Vanthuyne, Nicolas; Crassous, Jeanne; Avarvari, Narcis |
| Journal of publication |
Chem. Commun. |
| Year of publication |
2017 |
| a |
20.358 ± 0.0007 Å |
| b |
7.9519 ± 0.0014 Å |
| c |
33.16 ± 0.003 Å |
| α |
90° |
| β |
107.08 ± 0.007° |
| γ |
90° |
| Cell volume |
5131.3 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0483 |
| Residual factor for significantly intense reflections |
0.0336 |
| Weighted residual factors for significantly intense reflections |
0.0733 |
| Weighted residual factors for all reflections included in the refinement |
0.0793 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.215 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7120496.html
