Information card for entry 7120529
| Formula |
C56 H58 B2 Cl6 |
| Calculated formula |
C56 H58 B2 Cl6 |
| SMILES |
B(c1ccccc1c1ccc(c2c(B(c3c(cc(cc3C)C)C)c3c(cc(cc3C)C)C)cccc2)cc1)(c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C.ClC(Cl)Cl.C(Cl)(Cl)Cl |
| Title of publication |
Consecutive reduction, radical-cyclization, and oxidative-dehydrogenation reaction of ortho-substituted diboryl compound |
| Authors of publication |
Yu, Lirong; Li, Yanglizhi; Wang, Xi; Wang, Xingyong; Zhou, Panpan; Jiang, ShangDa; pan, xiaobo |
| Journal of publication |
Chem. Commun. |
| Year of publication |
2017 |
| a |
15.3919 ± 0.0007 Å |
| b |
8.1281 ± 0.0004 Å |
| c |
20.3055 ± 0.0013 Å |
| α |
90° |
| β |
92.736 ± 0.005° |
| γ |
90° |
| Cell volume |
2537.5 ± 0.2 Å3 |
| Cell temperature |
290.56 ± 0.1 K |
| Ambient diffraction temperature |
290.56 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0957 |
| Residual factor for significantly intense reflections |
0.0602 |
| Weighted residual factors for significantly intense reflections |
0.129 |
| Weighted residual factors for all reflections included in the refinement |
0.1554 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7120529.html